C16H24N4O3 — CID 92632361
(1-ethylpyrazol-3-yl)-[(2S)-2-methyl-2-(morpholine-4-carbonyl)pyrrolidin-1-yl]methanone (PubChem CID 92632361) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is (1-ethylpyrazol-3-yl)-[(2S)-2-methyl-2-(morpholine-4-carbonyl)pyrrolidin-1-yl]methanone.
| Compound Name | (1-ethylpyrazol-3-yl)-[(2S)-2-methyl-2-(morpholine-4-carbonyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 92632361 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (1-ethylpyrazol-3-yl)-[(2S)-2-methyl-2-(morpholine-4-carbonyl)pyrrolidin-1-yl]methanone |
| SMILES | CCn1ccc(C(=O)N2CCC[C@@]2(C)C(=O)N2CCOCC2)n1 |
| InChI | InChI=1S/C16H24N4O3/c1-3-19-8-5-13(17-19)14(21)20-7-4-6-16(20,2)15(22)18-9-11-23-12-10-18/h5,8H,3-4,6-7,9-12H2,1-2H3/t16-/m0/s1 |
| InChIKey | HSZIAIDMQUFGPY-INIZCTEOSA-N |
| XLogP | 0.76 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |