C15H27N5O3S — CID 92634262
(2S)-2-[2-(dimethylsulfamoylamino)ethyl]-1-[2-(4-methylpyrazol-1-yl)acetyl]piperidine (PubChem CID 92634262) has the molecular formula C15H27N5O3S and a molecular weight of 357.48 g/mol. Its IUPAC name is (2S)-2-[2-(dimethylsulfamoylamino)ethyl]-1-[2-(4-methylpyrazol-1-yl)acetyl]piperidine.
| Compound Name | (2S)-2-[2-(dimethylsulfamoylamino)ethyl]-1-[2-(4-methylpyrazol-1-yl)acetyl]piperidine |
|---|---|
| PubChem CID | 92634262 |
| Molecular Formula | C15H27N5O3S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | (2S)-2-[2-(dimethylsulfamoylamino)ethyl]-1-[2-(4-methylpyrazol-1-yl)acetyl]piperidine |
| SMILES | Cc1cnn(CC(=O)N2CCCC[C@H]2CCNS(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C15H27N5O3S/c1-13-10-16-19(11-13)12-15(21)20-9-5-4-6-14(20)7-8-17-24(22,23)18(2)3/h10-11,14,17H,4-9,12H2,1-3H3/t14-/m0/s1 |
| InChIKey | OPKBBVGAUXHELQ-AWEZNQCLSA-N |
| XLogP | 0.36 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |