C23H30N4O3 — CID 92636501
N-(2-methoxyphenyl)-4-methyl-2-[(2S)-1-(oxan-4-yl)piperidin-2-yl]pyrimidine-5-carboxamide (PubChem CID 92636501) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-4-methyl-2-[(2S)-1-(oxan-4-yl)piperidin-2-yl]pyrimidine-5-carboxamide.
| Compound Name | N-(2-methoxyphenyl)-4-methyl-2-[(2S)-1-(oxan-4-yl)piperidin-2-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 92636501 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | N-(2-methoxyphenyl)-4-methyl-2-[(2S)-1-(oxan-4-yl)piperidin-2-yl]pyrimidine-5-carboxamide |
| SMILES | COc1ccccc1NC(=O)c1cnc([C@@H]2CCCCN2C2CCOCC2)nc1C |
| InChI | InChI=1S/C23H30N4O3/c1-16-18(23(28)26-19-7-3-4-9-21(19)29-2)15-24-22(25-16)20-8-5-6-12-27(20)17-10-13-30-14-11-17/h3-4,7,9,15,17,20H,5-6,8,10-14H2,1-2H3,(H,26,28)/t20-/m0/s1 |
| InChIKey | YPYQGRYKXNIROT-FQEVSTJZSA-N |
| XLogP | 3.75 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |