C25H27N3O3 — CID 92636941
2-[(3R)-1-[3-(4-methoxyphenyl)propanoyl]pyrrolidin-3-yl]-N-methylquinoline-4-carboxamide (PubChem CID 92636941) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 2-[(3R)-1-[3-(4-methoxyphenyl)propanoyl]pyrrolidin-3-yl]-N-methylquinoline-4-carboxamide.
| Compound Name | 2-[(3R)-1-[3-(4-methoxyphenyl)propanoyl]pyrrolidin-3-yl]-N-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 92636941 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 2-[(3R)-1-[3-(4-methoxyphenyl)propanoyl]pyrrolidin-3-yl]-N-methylquinoline-4-carboxamide |
| SMILES | CNC(=O)c1cc([C@@H]2CCN(C(=O)CCc3ccc(OC)cc3)C2)nc2ccccc12 |
| InChI | InChI=1S/C25H27N3O3/c1-26-25(30)21-15-23(27-22-6-4-3-5-20(21)22)18-13-14-28(16-18)24(29)12-9-17-7-10-19(31-2)11-8-17/h3-8,10-11,15,18H,9,12-14,16H2,1-2H3,(H,26,30)/t18-/m1/s1 |
| InChIKey | JSBBBPILMRRKHQ-GOSISDBHSA-N |
| XLogP | 3.55 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |