C24H28N4O2S — CID 92637050
2-[(2R)-4-cycloheptylmorpholin-2-yl]-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide (PubChem CID 92637050) has the molecular formula C24H28N4O2S and a molecular weight of 436.58 g/mol. Its IUPAC name is 2-[(2R)-4-cycloheptylmorpholin-2-yl]-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide.
| Compound Name | 2-[(2R)-4-cycloheptylmorpholin-2-yl]-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 92637050 |
| Molecular Formula | C24H28N4O2S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 2-[(2R)-4-cycloheptylmorpholin-2-yl]-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide |
| SMILES | O=C(Nc1nccs1)c1cc([C@H]2CN(C3CCCCCC3)CCO2)nc2ccccc12 |
| InChI | InChI=1S/C24H28N4O2S/c29-23(27-24-25-11-14-31-24)19-15-21(26-20-10-6-5-9-18(19)20)22-16-28(12-13-30-22)17-7-3-1-2-4-8-17/h5-6,9-11,14-15,17,22H,1-4,7-8,12-13,16H2,(H,25,27,29)/t22-/m1/s1 |
| InChIKey | WWLLNTMULYQURW-JOCHJYFZSA-N |
| XLogP | 5.04 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |