C24H29FN4O3 — CID 92637374
4-(2-fluorophenoxy)-1-[(2S)-2-[4-methyl-5-(pyrrolidine-1-carbonyl)pyrimidin-2-yl]pyrrolidin-1-yl]butan-1-one (PubChem CID 92637374) has the molecular formula C24H29FN4O3 and a molecular weight of 440.52 g/mol. Its IUPAC name is 4-(2-fluorophenoxy)-1-[(2S)-2-[4-methyl-5-(pyrrolidine-1-carbonyl)pyrimidin-2-yl]pyrrolidin-1-yl]butan-1-one.
| Compound Name | 4-(2-fluorophenoxy)-1-[(2S)-2-[4-methyl-5-(pyrrolidine-1-carbonyl)pyrimidin-2-yl]pyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 92637374 |
| Molecular Formula | C24H29FN4O3 |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 4-(2-fluorophenoxy)-1-[(2S)-2-[4-methyl-5-(pyrrolidine-1-carbonyl)pyrimidin-2-yl]pyrrolidin-1-yl]butan-1-one |
| SMILES | Cc1nc([C@@H]2CCCN2C(=O)CCCOc2ccccc2F)ncc1C(=O)N1CCCC1 |
| InChI | InChI=1S/C24H29FN4O3/c1-17-18(24(31)28-12-4-5-13-28)16-26-23(27-17)20-9-6-14-29(20)22(30)11-7-15-32-21-10-3-2-8-19(21)25/h2-3,8,10,16,20H,4-7,9,11-15H2,1H3/t20-/m0/s1 |
| InChIKey | UQZSPESJJLKZRL-FQEVSTJZSA-N |
| XLogP | 3.68 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|