C24H27N5O3 — CID 92637916
N-(2-methoxyethyl)-2-[(3R)-1-[2-(methylamino)pyridine-4-carbonyl]pyrrolidin-3-yl]quinoline-4-carboxamide (PubChem CID 92637916) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[(3R)-1-[2-(methylamino)pyridine-4-carbonyl]pyrrolidin-3-yl]quinoline-4-carboxamide.
| Compound Name | N-(2-methoxyethyl)-2-[(3R)-1-[2-(methylamino)pyridine-4-carbonyl]pyrrolidin-3-yl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 92637916 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | N-(2-methoxyethyl)-2-[(3R)-1-[2-(methylamino)pyridine-4-carbonyl]pyrrolidin-3-yl]quinoline-4-carboxamide |
| SMILES | CNc1cc(C(=O)N2CC[C@@H](c3cc(C(=O)NCCOC)c4ccccc4n3)C2)ccn1 |
| InChI | InChI=1S/C24H27N5O3/c1-25-22-13-16(7-9-26-22)24(31)29-11-8-17(15-29)21-14-19(23(30)27-10-12-32-2)18-5-3-4-6-20(18)28-21/h3-7,9,13-14,17H,8,10-12,15H2,1-2H3,(H,25,26)(H,27,30)/t17-/m1/s1 |
| InChIKey | NWJROJQMQYGJTK-QGZVFWFLSA-N |
| XLogP | 2.68 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|