C24H33N5O3 — CID 92640321
2-[1-[3-(4-methoxy-N-methylanilino)propanoyl]piperidin-4-yl]-N,N,4-trimethylpyrimidine-5-carboxamide (PubChem CID 92640321) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-[1-[3-(4-methoxy-N-methylanilino)propanoyl]piperidin-4-yl]-N,N,4-trimethylpyrimidine-5-carboxamide.
| Compound Name | 2-[1-[3-(4-methoxy-N-methylanilino)propanoyl]piperidin-4-yl]-N,N,4-trimethylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 92640321 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | 2-[1-[3-(4-methoxy-N-methylanilino)propanoyl]piperidin-4-yl]-N,N,4-trimethylpyrimidine-5-carboxamide |
| SMILES | COc1ccc(N(C)CCC(=O)N2CCC(c3ncc(C(=O)N(C)C)c(C)n3)CC2)cc1 |
| InChI | InChI=1S/C24H33N5O3/c1-17-21(24(31)27(2)3)16-25-23(26-17)18-10-14-29(15-11-18)22(30)12-13-28(4)19-6-8-20(32-5)9-7-19/h6-9,16,18H,10-15H2,1-5H3 |
| InChIKey | SQQCLHXASOPCKO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|