C16H21ClN2O3S — CID 92641774
(3S)-1-[(3-chlorophenyl)methylsulfonyl]-N-cyclopropylpiperidine-3-carboxamide (PubChem CID 92641774) has the molecular formula C16H21ClN2O3S and a molecular weight of 356.88 g/mol. Its IUPAC name is (3S)-1-[(3-chlorophenyl)methylsulfonyl]-N-cyclopropylpiperidine-3-carboxamide.
| Compound Name | (3S)-1-[(3-chlorophenyl)methylsulfonyl]-N-cyclopropylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 92641774 |
| Molecular Formula | C16H21ClN2O3S |
| Molecular Weight | 356.88 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | (3S)-1-[(3-chlorophenyl)methylsulfonyl]-N-cyclopropylpiperidine-3-carboxamide |
| SMILES | O=C(NC1CC1)[C@H]1CCCN(S(=O)(=O)Cc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C16H21ClN2O3S/c17-14-5-1-3-12(9-14)11-23(21,22)19-8-2-4-13(10-19)16(20)18-15-6-7-15/h1,3,5,9,13,15H,2,4,6-8,10-11H2,(H,18,20)/t13-/m0/s1 |
| InChIKey | ORAPUIXIKHWDCI-ZDUSSCGKSA-N |
| XLogP | 2.16 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.88 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |