C19H20Cl2N2O3S — CID 92641906
(3S)-N-(3-chlorophenyl)-1-[(4-chlorophenyl)methylsulfonyl]piperidine-3-carboxamide (PubChem CID 92641906) has the molecular formula C19H20Cl2N2O3S and a molecular weight of 427.35 g/mol. Its IUPAC name is (3S)-N-(3-chlorophenyl)-1-[(4-chlorophenyl)methylsulfonyl]piperidine-3-carboxamide.
| Compound Name | (3S)-N-(3-chlorophenyl)-1-[(4-chlorophenyl)methylsulfonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92641906 |
| Molecular Formula | C19H20Cl2N2O3S |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | (3S)-N-(3-chlorophenyl)-1-[(4-chlorophenyl)methylsulfonyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)[C@H]1CCCN(S(=O)(=O)Cc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C19H20Cl2N2O3S/c20-16-8-6-14(7-9-16)13-27(25,26)23-10-2-3-15(12-23)19(24)22-18-5-1-4-17(21)11-18/h1,4-9,11,15H,2-3,10,12-13H2,(H,22,24)/t15-/m0/s1 |
| InChIKey | YCBZBTSEMQVQGQ-HNNXBMFYSA-N |
| XLogP | 4.17 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |