C21H31NO6S — CID 92642213
[(2R,3S,4S,5S)-4-benzamido-2-[(1R)-3,3-dimethylcyclopentyl]-5-ethoxyoxolan-3-yl] methanesulfonate (PubChem CID 92642213) has the molecular formula C21H31NO6S and a molecular weight of 425.55 g/mol. Its IUPAC name is [(2R,3S,4S,5S)-4-benzamido-2-[(1R)-3,3-dimethylcyclopentyl]-5-ethoxyoxolan-3-yl] methanesulfonate.
| Compound Name | [(2R,3S,4S,5S)-4-benzamido-2-[(1R)-3,3-dimethylcyclopentyl]-5-ethoxyoxolan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 92642213 |
| Molecular Formula | C21H31NO6S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | [(2R,3S,4S,5S)-4-benzamido-2-[(1R)-3,3-dimethylcyclopentyl]-5-ethoxyoxolan-3-yl] methanesulfonate |
| SMILES | CCO[C@H]1O[C@H]([C@@H]2CCC(C)(C)C2)[C@@H](OS(C)(=O)=O)[C@@H]1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H31NO6S/c1-5-26-20-16(22-19(23)14-9-7-6-8-10-14)18(28-29(4,24)25)17(27-20)15-11-12-21(2,3)13-15/h6-10,15-18,20H,5,11-13H2,1-4H3,(H,22,23)/t15-,16+,17-,18+,20+/m1/s1 |
| InChIKey | VJNPFHBGYKJSRT-GJNTUIEKSA-N |
| XLogP | 2.72 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|