C23H19NO3S — CID 92643170
7-methoxy-N-[4-(phenylsulfanylmethyl)phenyl]-1-benzofuran-2-carboxamide (PubChem CID 92643170) has the molecular formula C23H19NO3S and a molecular weight of 389.48 g/mol. Its IUPAC name is 7-methoxy-N-[4-(phenylsulfanylmethyl)phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | 7-methoxy-N-[4-(phenylsulfanylmethyl)phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 92643170 |
| Molecular Formula | C23H19NO3S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 7-methoxy-N-[4-(phenylsulfanylmethyl)phenyl]-1-benzofuran-2-carboxamide |
| SMILES | COc1cccc2cc(C(=O)Nc3ccc(CSc4ccccc4)cc3)oc12 |
| InChI | InChI=1S/C23H19NO3S/c1-26-20-9-5-6-17-14-21(27-22(17)20)23(25)24-18-12-10-16(11-13-18)15-28-19-7-3-2-4-8-19/h2-14H,15H2,1H3,(H,24,25) |
| InChIKey | FKQCMORJSGKAQI-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |