C22H20BrFN2O3S — CID 92645922
(2R)-2-[(4-bromophenyl)sulfonylamino]-N-(5-fluoro-2-methylphenyl)-3-phenylpropanamide (PubChem CID 92645922) has the molecular formula C22H20BrFN2O3S and a molecular weight of 491.38 g/mol. Its IUPAC name is (2R)-2-[(4-bromophenyl)sulfonylamino]-N-(5-fluoro-2-methylphenyl)-3-phenylpropanamide.
| Compound Name | (2R)-2-[(4-bromophenyl)sulfonylamino]-N-(5-fluoro-2-methylphenyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 92645922 |
| Molecular Formula | C22H20BrFN2O3S |
| Molecular Weight | 491.38 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | (2R)-2-[(4-bromophenyl)sulfonylamino]-N-(5-fluoro-2-methylphenyl)-3-phenylpropanamide |
| SMILES | Cc1ccc(F)cc1NC(=O)[C@@H](Cc1ccccc1)NS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H20BrFN2O3S/c1-15-7-10-18(24)14-20(15)25-22(27)21(13-16-5-3-2-4-6-16)26-30(28,29)19-11-8-17(23)9-12-19/h2-12,14,21,26H,13H2,1H3,(H,25,27)/t21-/m1/s1 |
| InChIKey | NEWCJTWRCLOGDW-OAQYLSRUSA-N |
| XLogP | 4.42 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |