C20H22Cl2N2O4S2 — CID 92646616
N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-4-methoxy-3-(2-oxopyrrolidin-1-yl)benzenesulfonamide (PubChem CID 92646616) has the molecular formula C20H22Cl2N2O4S2 and a molecular weight of 489.45 g/mol. Its IUPAC name is N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-4-methoxy-3-(2-oxopyrrolidin-1-yl)benzenesulfonamide.
| Compound Name | N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-4-methoxy-3-(2-oxopyrrolidin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 92646616 |
| Molecular Formula | C20H22Cl2N2O4S2 |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 488.04 |
| IUPAC Name | N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-4-methoxy-3-(2-oxopyrrolidin-1-yl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCSCc2ccc(Cl)c(Cl)c2)cc1N1CCCC1=O |
| InChI | InChI=1S/C20H22Cl2N2O4S2/c1-28-19-7-5-15(12-18(19)24-9-2-3-20(24)25)30(26,27)23-8-10-29-13-14-4-6-16(21)17(22)11-14/h4-7,11-12,23H,2-3,8-10,13H2,1H3 |
| InChIKey | BCJKJIUUXNEDSM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|