About cyclooctyl-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]azanium
cyclooctyl-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]azanium (PubChem CID 9265077) has the molecular formula C15H22N3OS+
and a molecular weight of 292.43 g/mol. Its IUPAC name is cyclooctyl-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]azanium.
Molecular Properties
| Compound Name | cyclooctyl-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]azanium |
| PubChem CID | 9265077 |
| Molecular Formula | C15H22N3OS+ |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | cyclooctyl-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]azanium |
| SMILES | O=c1cc(C[NH2+]C2CCCCCCC2)nc2sccn12 |
| InChI | InChI=1S/C15H21N3OS/c19-14-10-13(17-15-18(14)8-9-20-15)11-16-12-6-4-2-1-3-5-7-12/h8-10,12,16H,1-7,11H2/p+1 |
| InChIKey | LUTZMLFUADJQCC-UHFFFAOYSA-O |
| XLogP | 1.93 |
| TPSA | 50.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclooctyl-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclooctyl-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]azanium?
The IUPAC name of cyclooctyl-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]azanium (CID 9265077) is cyclooctyl-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]azanium.
What is the SMILES notation for cyclooctyl-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]azanium?
The canonical SMILES for cyclooctyl-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]azanium is O=c1cc(C[NH2+]C2CCCCCCC2)nc2sccn12.
What is the InChIKey of cyclooctyl-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]azanium?
The InChIKey is LUTZMLFUADJQCC-UHFFFAOYSA-O. The full InChI is InChI=1S/C15H21N3OS/c19-14-10-13(17-15-18(14)8-9-20-15)11-16-12-6-4-2-1-3-5-7-12/h8-10,12,16H,1-7,11H2/p+1.
What are the key properties of cyclooctyl-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]azanium?
cyclooctyl-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]azanium has a molecular weight of 292.43 g/mol, XLogP of 1.93, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclooctyl-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]azanium is sourced from PubChem (CID 9265077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).