C17H21N5OS — CID 92651313
[(6R,7R)-3-methyl-6-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-piperidin-1-ylmethanone (PubChem CID 92651313) has the molecular formula C17H21N5OS and a molecular weight of 343.46 g/mol. Its IUPAC name is [(6R,7R)-3-methyl-6-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-piperidin-1-ylmethanone.
| Compound Name | [(6R,7R)-3-methyl-6-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 92651313 |
| Molecular Formula | C17H21N5OS |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | [(6R,7R)-3-methyl-6-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-piperidin-1-ylmethanone |
| SMILES | Cc1nnc2n1N[C@H](c1ccccc1)[C@H](C(=O)N1CCCCC1)S2 |
| InChI | InChI=1S/C17H21N5OS/c1-12-18-19-17-22(12)20-14(13-8-4-2-5-9-13)15(24-17)16(23)21-10-6-3-7-11-21/h2,4-5,8-9,14-15,20H,3,6-7,10-11H2,1H3/t14-,15-/m1/s1 |
| InChIKey | TYFOMYTUOQLFTG-HUUCEWRRSA-N |
| XLogP | 2.36 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |