C16H21N5O3S — CID 92651431
(6R,7S)-N-(2-methoxyethyl)-6-(4-methoxyphenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide (PubChem CID 92651431) has the molecular formula C16H21N5O3S and a molecular weight of 363.44 g/mol. Its IUPAC name is (6R,7S)-N-(2-methoxyethyl)-6-(4-methoxyphenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide.
| Compound Name | (6R,7S)-N-(2-methoxyethyl)-6-(4-methoxyphenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 92651431 |
| Molecular Formula | C16H21N5O3S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | (6R,7S)-N-(2-methoxyethyl)-6-(4-methoxyphenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
| SMILES | COCCNC(=O)[C@H]1Sc2nnc(C)n2N[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C16H21N5O3S/c1-10-18-19-16-21(10)20-13(11-4-6-12(24-3)7-5-11)14(25-16)15(22)17-8-9-23-2/h4-7,13-14,20H,8-9H2,1-3H3,(H,17,22)/t13-,14+/m1/s1 |
| InChIKey | XHUCGMODMDCVHP-KGLIPLIRSA-N |
| XLogP | 1.12 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|