C18H28BrN2O+ — CID 9265234
[2-[[(1S)-1-(4-bromophenyl)ethyl]amino]-2-oxoethyl]-cyclooctylazanium (PubChem CID 9265234) has the molecular formula C18H28BrN2O+ and a molecular weight of 368.34 g/mol. Its IUPAC name is [2-[[(1S)-1-(4-bromophenyl)ethyl]amino]-2-oxoethyl]-cyclooctylazanium.
| Compound Name | [2-[[(1S)-1-(4-bromophenyl)ethyl]amino]-2-oxoethyl]-cyclooctylazanium |
|---|---|
| PubChem CID | 9265234 |
| Molecular Formula | C18H28BrN2O+ |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | [2-[[(1S)-1-(4-bromophenyl)ethyl]amino]-2-oxoethyl]-cyclooctylazanium |
| SMILES | C[C@H](NC(=O)C[NH2+]C1CCCCCCC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H27BrN2O/c1-14(15-9-11-16(19)12-10-15)21-18(22)13-20-17-7-5-3-2-4-6-8-17/h9-12,14,17,20H,2-8,13H2,1H3,(H,21,22)/p+1/t14-/m0/s1 |
| InChIKey | MJKHDQPNVZJXKY-AWEZNQCLSA-O |
| XLogP | 3.30 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |