C25H32N4O5 — CID 92654063
(3S,4S)-6,7-dimethoxy-2-methyl-N-(3-morpholin-4-ylpropyl)-1-oxo-3-pyridin-3-yl-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 92654063) has the molecular formula C25H32N4O5 and a molecular weight of 468.55 g/mol. Its IUPAC name is (3S,4S)-6,7-dimethoxy-2-methyl-N-(3-morpholin-4-ylpropyl)-1-oxo-3-pyridin-3-yl-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3S,4S)-6,7-dimethoxy-2-methyl-N-(3-morpholin-4-ylpropyl)-1-oxo-3-pyridin-3-yl-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 92654063 |
| Molecular Formula | C25H32N4O5 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | (3S,4S)-6,7-dimethoxy-2-methyl-N-(3-morpholin-4-ylpropyl)-1-oxo-3-pyridin-3-yl-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | COc1cc2c(cc1OC)[C@H](C(=O)NCCCN1CCOCC1)[C@@H](c1cccnc1)N(C)C2=O |
| InChI | InChI=1S/C25H32N4O5/c1-28-23(17-6-4-7-26-16-17)22(24(30)27-8-5-9-29-10-12-34-13-11-29)18-14-20(32-2)21(33-3)15-19(18)25(28)31/h4,6-7,14-16,22-23H,5,8-13H2,1-3H3,(H,27,30)/t22-,23+/m0/s1 |
| InChIKey | GTPODSLIQFZXIX-XZOQPEGZSA-N |
| XLogP | 1.85 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|