C26H21Cl2N3O3 — CID 92654696
(3S,3aS,6aS)-5-(2,4-dichlorophenyl)-1-(4-methylbenzoyl)-3-(4-methylphenyl)-2,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrazole-4,6-dione (PubChem CID 92654696) has the molecular formula C26H21Cl2N3O3 and a molecular weight of 494.38 g/mol. Its IUPAC name is (3S,3aS,6aS)-5-(2,4-dichlorophenyl)-1-(4-methylbenzoyl)-3-(4-methylphenyl)-2,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrazole-4,6-dione.
| Compound Name | (3S,3aS,6aS)-5-(2,4-dichlorophenyl)-1-(4-methylbenzoyl)-3-(4-methylphenyl)-2,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrazole-4,6-dione |
|---|---|
| PubChem CID | 92654696 |
| Molecular Formula | C26H21Cl2N3O3 |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | (3S,3aS,6aS)-5-(2,4-dichlorophenyl)-1-(4-methylbenzoyl)-3-(4-methylphenyl)-2,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrazole-4,6-dione |
| SMILES | Cc1ccc(C(=O)N2N[C@H](c3ccc(C)cc3)[C@@H]3C(=O)N(c4ccc(Cl)cc4Cl)C(=O)[C@H]32)cc1 |
| InChI | InChI=1S/C26H21Cl2N3O3/c1-14-3-7-16(8-4-14)22-21-23(31(29-22)24(32)17-9-5-15(2)6-10-17)26(34)30(25(21)33)20-12-11-18(27)13-19(20)28/h3-13,21-23,29H,1-2H3/t21-,22+,23-/m0/s1 |
| InChIKey | PVFTYTQASHNRCW-ZRBLBEILSA-N |
| XLogP | 4.87 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|