C18H29N2O2+ — CID 9265502
cyclooctyl-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]azanium (PubChem CID 9265502) has the molecular formula C18H29N2O2+ and a molecular weight of 305.44 g/mol. Its IUPAC name is cyclooctyl-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]azanium.
| Compound Name | cyclooctyl-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9265502 |
| Molecular Formula | C18H29N2O2+ |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | cyclooctyl-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]azanium |
| SMILES | COc1ccc(CNC(=O)C[NH2+]C2CCCCCCC2)cc1 |
| InChI | InChI=1S/C18H28N2O2/c1-22-17-11-9-15(10-12-17)13-20-18(21)14-19-16-7-5-3-2-4-6-8-16/h9-12,16,19H,2-8,13-14H2,1H3,(H,20,21)/p+1 |
| InChIKey | QDYHCAWHEUSLLU-UHFFFAOYSA-O |
| XLogP | 1.99 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |