C24H19FN2O4S — CID 92655872
methyl (1R,3S,3aR,6aS)-5-(2-fluorophenyl)-4,6-dioxo-3-phenyl-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 92655872) has the molecular formula C24H19FN2O4S and a molecular weight of 450.49 g/mol. Its IUPAC name is methyl (1R,3S,3aR,6aS)-5-(2-fluorophenyl)-4,6-dioxo-3-phenyl-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl (1R,3S,3aR,6aS)-5-(2-fluorophenyl)-4,6-dioxo-3-phenyl-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 92655872 |
| Molecular Formula | C24H19FN2O4S |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | methyl (1R,3S,3aR,6aS)-5-(2-fluorophenyl)-4,6-dioxo-3-phenyl-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | COC(=O)[C@]1(c2ccccc2)N[C@@H](c2cccs2)[C@H]2C(=O)N(c3ccccc3F)C(=O)[C@H]21 |
| InChI | InChI=1S/C24H19FN2O4S/c1-31-23(30)24(14-8-3-2-4-9-14)19-18(20(26-24)17-12-7-13-32-17)21(28)27(22(19)29)16-11-6-5-10-15(16)25/h2-13,18-20,26H,1H3/t18-,19-,20-,24+/m0/s1 |
| InChIKey | KVZJZJYOCXJZBP-AZXNSQLWSA-N |
| XLogP | 3.41 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|