C16H28N3O+ — CID 9265619
[2-[[(1R)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl]-cyclooctylazanium (PubChem CID 9265619) has the molecular formula C16H28N3O+ and a molecular weight of 278.42 g/mol. Its IUPAC name is [2-[[(1R)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl]-cyclooctylazanium.
| Compound Name | [2-[[(1R)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl]-cyclooctylazanium |
|---|---|
| PubChem CID | 9265619 |
| Molecular Formula | C16H28N3O+ |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | [2-[[(1R)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl]-cyclooctylazanium |
| SMILES | C[C@@](C#N)(NC(=O)C[NH2+]C1CCCCCCC1)C1CC1 |
| InChI | InChI=1S/C16H27N3O/c1-16(12-17,13-9-10-13)19-15(20)11-18-14-7-5-3-2-4-6-8-14/h13-14,18H,2-11H2,1H3,(H,19,20)/p+1/t16-/m0/s1 |
| InChIKey | PKUSSDXTQKHHMV-INIZCTEOSA-O |
| XLogP | 1.47 |
| TPSA | 69.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |