C29H27F3N2O4 — CID 92656341
(13R,13aR)-2,3-diethoxy-8-oxo-N-[4-(trifluoromethyl)phenyl]-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide (PubChem CID 92656341) has the molecular formula C29H27F3N2O4 and a molecular weight of 524.54 g/mol. Its IUPAC name is (13R,13aR)-2,3-diethoxy-8-oxo-N-[4-(trifluoromethyl)phenyl]-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide.
| Compound Name | (13R,13aR)-2,3-diethoxy-8-oxo-N-[4-(trifluoromethyl)phenyl]-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
|---|---|
| PubChem CID | 92656341 |
| Molecular Formula | C29H27F3N2O4 |
| Molecular Weight | 524.54 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | (13R,13aR)-2,3-diethoxy-8-oxo-N-[4-(trifluoromethyl)phenyl]-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
| SMILES | CCOc1cc2c(cc1OCC)[C@H]1[C@H](C(=O)Nc3ccc(C(F)(F)F)cc3)c3ccccc3C(=O)N1CC2 |
| InChI | InChI=1S/C29H27F3N2O4/c1-3-37-23-15-17-13-14-34-26(22(17)16-24(23)38-4-2)25(20-7-5-6-8-21(20)28(34)36)27(35)33-19-11-9-18(10-12-19)29(30,31)32/h5-12,15-16,25-26H,3-4,13-14H2,1-2H3,(H,33,35)/t25-,26+/m1/s1 |
| InChIKey | SYLTZJMYAXXLHJ-FTJBHMTQSA-N |
| XLogP | 5.98 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.54 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |