C30H30N4O5 — CID 92657455
(1R,9R)-10-[3-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carbonyl]phenyl]-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-one (PubChem CID 92657455) has the molecular formula C30H30N4O5 and a molecular weight of 526.59 g/mol. Its IUPAC name is (1R,9R)-10-[3-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carbonyl]phenyl]-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-one.
| Compound Name | (1R,9R)-10-[3-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carbonyl]phenyl]-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-one |
|---|---|
| PubChem CID | 92657455 |
| Molecular Formula | C30H30N4O5 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | (1R,9R)-10-[3-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carbonyl]phenyl]-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-one |
| SMILES | C[C@@]12C[C@@H](NC(=O)N1c1cccc(C(=O)N3CCN(Cc4ccc5c(c4)OCO5)CC3)c1)c1ccccc1O2 |
| InChI | InChI=1S/C30H30N4O5/c1-30-17-24(23-7-2-3-8-25(23)39-30)31-29(36)34(30)22-6-4-5-21(16-22)28(35)33-13-11-32(12-14-33)18-20-9-10-26-27(15-20)38-19-37-26/h2-10,15-16,24H,11-14,17-19H2,1H3,(H,31,36)/t24-,30-/m1/s1 |
| InChIKey | VVYJKSOHCUKTOZ-AYWVHJORSA-N |
| XLogP | 4.14 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |