C12H14N4O2S — CID 92659579
N-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-4-ethoxybenzamide (PubChem CID 92659579) has the molecular formula C12H14N4O2S and a molecular weight of 278.34 g/mol. Its IUPAC name is N-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-4-ethoxybenzamide.
| Compound Name | N-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 92659579 |
| Molecular Formula | C12H14N4O2S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | N-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NCc2nnc(N)s2)cc1 |
| InChI | InChI=1S/C12H14N4O2S/c1-2-18-9-5-3-8(4-6-9)11(17)14-7-10-15-16-12(13)19-10/h3-6H,2,7H2,1H3,(H2,13,16)(H,14,17) |
| InChIKey | WODAGGZSIHBHGE-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |