C12H15ClN2O2S — CID 92660282
(2R)-2-chloro-N-(5,5-dimethyl-7-oxo-4,6-dihydro-1,3-benzothiazol-2-yl)propanamide (PubChem CID 92660282) has the molecular formula C12H15ClN2O2S and a molecular weight of 286.78 g/mol. Its IUPAC name is (2R)-2-chloro-N-(5,5-dimethyl-7-oxo-4,6-dihydro-1,3-benzothiazol-2-yl)propanamide.
| Compound Name | (2R)-2-chloro-N-(5,5-dimethyl-7-oxo-4,6-dihydro-1,3-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 92660282 |
| Molecular Formula | C12H15ClN2O2S |
| Molecular Weight | 286.78 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | (2R)-2-chloro-N-(5,5-dimethyl-7-oxo-4,6-dihydro-1,3-benzothiazol-2-yl)propanamide |
| SMILES | C[C@@H](Cl)C(=O)Nc1nc2c(s1)C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C12H15ClN2O2S/c1-6(13)10(17)15-11-14-7-4-12(2,3)5-8(16)9(7)18-11/h6H,4-5H2,1-3H3,(H,14,15,17)/t6-/m1/s1 |
| InChIKey | CHBARQOWYDZXCS-ZCFIWIBFSA-N |
| XLogP | 2.86 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.78 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|