C24H17ClN4O3 — CID 92660924
(4S)-5-(4-chlorophenyl)-3-(4-methylphenyl)-4-(4-nitrophenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one (PubChem CID 92660924) has the molecular formula C24H17ClN4O3 and a molecular weight of 444.88 g/mol. Its IUPAC name is (4S)-5-(4-chlorophenyl)-3-(4-methylphenyl)-4-(4-nitrophenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one.
| Compound Name | (4S)-5-(4-chlorophenyl)-3-(4-methylphenyl)-4-(4-nitrophenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
|---|---|
| PubChem CID | 92660924 |
| Molecular Formula | C24H17ClN4O3 |
| Molecular Weight | 444.88 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | (4S)-5-(4-chlorophenyl)-3-(4-methylphenyl)-4-(4-nitrophenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
| SMILES | Cc1ccc(-c2n[nH]c3c2[C@H](c2ccc([N+](=O)[O-])cc2)N(c2ccc(Cl)cc2)C3=O)cc1 |
| InChI | InChI=1S/C24H17ClN4O3/c1-14-2-4-15(5-3-14)21-20-22(27-26-21)24(30)28(18-12-8-17(25)9-13-18)23(20)16-6-10-19(11-7-16)29(31)32/h2-13,23H,1H3,(H,26,27)/t23-/m0/s1 |
| InChIKey | LWEGDDVCSGKRNI-QHCPKHFHSA-N |
| XLogP | 5.70 |
| TPSA | 92.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.88 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|