C23H27N3O3 — CID 92661045
ethyl (4R)-4-(4-methylphenyl)-2-oxo-6-[(2-phenylethylamino)methyl]-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 92661045) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is ethyl (4R)-4-(4-methylphenyl)-2-oxo-6-[(2-phenylethylamino)methyl]-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4R)-4-(4-methylphenyl)-2-oxo-6-[(2-phenylethylamino)methyl]-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 92661045 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | ethyl (4R)-4-(4-methylphenyl)-2-oxo-6-[(2-phenylethylamino)methyl]-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(CNCCc2ccccc2)NC(=O)N[C@@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C23H27N3O3/c1-3-29-22(27)20-19(15-24-14-13-17-7-5-4-6-8-17)25-23(28)26-21(20)18-11-9-16(2)10-12-18/h4-12,21,24H,3,13-15H2,1-2H3,(H2,25,26,28)/t21-/m1/s1 |
| InChIKey | KPMCSBYNCXUGRK-OAQYLSRUSA-N |
| XLogP | 3.00 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|