C24H32N4O2S — CID 92661763
N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-3-(3-methoxyphenyl)-1-methylthieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 92661763) has the molecular formula C24H32N4O2S and a molecular weight of 440.61 g/mol. Its IUPAC name is N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-3-(3-methoxyphenyl)-1-methylthieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-3-(3-methoxyphenyl)-1-methylthieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 92661763 |
| Molecular Formula | C24H32N4O2S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-3-(3-methoxyphenyl)-1-methylthieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | COc1cccc(-c2nn(C)c3sc(C(=O)NCCCN4C[C@H](C)C[C@@H](C)C4)cc23)c1 |
| InChI | InChI=1S/C24H32N4O2S/c1-16-11-17(2)15-28(14-16)10-6-9-25-23(29)21-13-20-22(26-27(3)24(20)31-21)18-7-5-8-19(12-18)30-4/h5,7-8,12-13,16-17H,6,9-11,14-15H2,1-4H3,(H,25,29)/t16-,17-/m1/s1 |
| InChIKey | XQAYBFFZXIWDBY-IAGOWNOFSA-N |
| XLogP | 4.41 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|