C26H34N2O3S — CID 92662085
(2R)-2-[(2S)-4-[(2,5-dimethylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-yl]-N-(3-propan-2-yloxypropyl)propanamide (PubChem CID 92662085) has the molecular formula C26H34N2O3S and a molecular weight of 454.64 g/mol. Its IUPAC name is (2R)-2-[(2S)-4-[(2,5-dimethylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-yl]-N-(3-propan-2-yloxypropyl)propanamide.
| Compound Name | (2R)-2-[(2S)-4-[(2,5-dimethylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-yl]-N-(3-propan-2-yloxypropyl)propanamide |
|---|---|
| PubChem CID | 92662085 |
| Molecular Formula | C26H34N2O3S |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | (2R)-2-[(2S)-4-[(2,5-dimethylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-yl]-N-(3-propan-2-yloxypropyl)propanamide |
| SMILES | Cc1ccc(C)c(CN2C(=O)[C@H]([C@H](C)C(=O)NCCCOC(C)C)Sc3ccccc32)c1 |
| InChI | InChI=1S/C26H34N2O3S/c1-17(2)31-14-8-13-27-25(29)20(5)24-26(30)28(22-9-6-7-10-23(22)32-24)16-21-15-18(3)11-12-19(21)4/h6-7,9-12,15,17,20,24H,8,13-14,16H2,1-5H3,(H,27,29)/t20-,24-/m0/s1 |
| InChIKey | IUFCZFAFMPSWRM-RDPSFJRHSA-N |
| XLogP | 4.88 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|