C25H31N3O4S — CID 92663196
5-ethyl-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]-6,11,11-trioxobenzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 92663196) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is 5-ethyl-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]-6,11,11-trioxobenzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | 5-ethyl-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]-6,11,11-trioxobenzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 92663196 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 5-ethyl-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]-6,11,11-trioxobenzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CCN1C(=O)c2ccccc2S(=O)(=O)c2ccc(C(=O)NCCCN3CCC[C@@H](C)C3)cc21 |
| InChI | InChI=1S/C25H31N3O4S/c1-3-28-21-16-19(24(29)26-13-7-15-27-14-6-8-18(2)17-27)11-12-23(21)33(31,32)22-10-5-4-9-20(22)25(28)30/h4-5,9-12,16,18H,3,6-8,13-15,17H2,1-2H3,(H,26,29)/t18-/m1/s1 |
| InChIKey | UXEXJLOBPGTHHL-GOSISDBHSA-N |
| XLogP | 3.35 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|