C20H25BrN4O — CID 92663450
N-[(Z)-(4-bromo-2,5-dimethyl-1-phenylpyrrol-3-yl)methylideneamino]-2-piperidin-1-ylacetamide (PubChem CID 92663450) has the molecular formula C20H25BrN4O and a molecular weight of 417.35 g/mol. Its IUPAC name is N-[(Z)-(4-bromo-2,5-dimethyl-1-phenylpyrrol-3-yl)methylideneamino]-2-piperidin-1-ylacetamide.
| Compound Name | N-[(Z)-(4-bromo-2,5-dimethyl-1-phenylpyrrol-3-yl)methylideneamino]-2-piperidin-1-ylacetamide |
|---|---|
| PubChem CID | 92663450 |
| Molecular Formula | C20H25BrN4O |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | N-[(Z)-(4-bromo-2,5-dimethyl-1-phenylpyrrol-3-yl)methylideneamino]-2-piperidin-1-ylacetamide |
| SMILES | Cc1c(Br)c(/C=N\NC(=O)CN2CCCCC2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C20H25BrN4O/c1-15-18(13-22-23-19(26)14-24-11-7-4-8-12-24)20(21)16(2)25(15)17-9-5-3-6-10-17/h3,5-6,9-10,13H,4,7-8,11-12,14H2,1-2H3,(H,23,26)/b22-13- |
| InChIKey | WATXDYFVCCJQIW-XKZIYDEJSA-N |
| XLogP | 3.79 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|