C24H21ClN2O3S — CID 92665603
(4-chlorothieno[3,2-c]quinolin-2-yl)-[(1R)-6,7-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl]methanone (PubChem CID 92665603) has the molecular formula C24H21ClN2O3S and a molecular weight of 452.96 g/mol. Its IUPAC name is (4-chlorothieno[3,2-c]quinolin-2-yl)-[(1R)-6,7-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl]methanone.
| Compound Name | (4-chlorothieno[3,2-c]quinolin-2-yl)-[(1R)-6,7-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
|---|---|
| PubChem CID | 92665603 |
| Molecular Formula | C24H21ClN2O3S |
| Molecular Weight | 452.96 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | (4-chlorothieno[3,2-c]quinolin-2-yl)-[(1R)-6,7-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
| SMILES | COc1cc2c(cc1OC)[C@@H](C)N(C(=O)c1cc3c(Cl)nc4ccccc4c3s1)CC2 |
| InChI | InChI=1S/C24H21ClN2O3S/c1-13-16-11-20(30-3)19(29-2)10-14(16)8-9-27(13)24(28)21-12-17-22(31-21)15-6-4-5-7-18(15)26-23(17)25/h4-7,10-13H,8-9H2,1-3H3/t13-/m1/s1 |
| InChIKey | ULUZBWAUJAZEAX-CYBMUJFWSA-N |
| XLogP | 5.88 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.96 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|