C24H21N3O4S — CID 92666370
(2E)-2-[(3,4-dimethylphenyl)sulfonylhydrazinylidene]-N-phenylchromene-3-carboxamide (PubChem CID 92666370) has the molecular formula C24H21N3O4S and a molecular weight of 447.52 g/mol. Its IUPAC name is (2E)-2-[(3,4-dimethylphenyl)sulfonylhydrazinylidene]-N-phenylchromene-3-carboxamide.
| Compound Name | (2E)-2-[(3,4-dimethylphenyl)sulfonylhydrazinylidene]-N-phenylchromene-3-carboxamide |
|---|---|
| PubChem CID | 92666370 |
| Molecular Formula | C24H21N3O4S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | (2E)-2-[(3,4-dimethylphenyl)sulfonylhydrazinylidene]-N-phenylchromene-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=c2/oc3ccccc3cc2C(=O)Nc2ccccc2)cc1C |
| InChI | InChI=1S/C24H21N3O4S/c1-16-12-13-20(14-17(16)2)32(29,30)27-26-24-21(15-18-8-6-7-11-22(18)31-24)23(28)25-19-9-4-3-5-10-19/h3-15,27H,1-2H3,(H,25,28)/b26-24+ |
| InChIKey | WLZPZFVOBPPZFI-SHHOIMCASA-N |
| XLogP | 4.10 |
| TPSA | 100.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|