C20H20N2O2 — CID 9266940
N-[(1R)-1-cyclopropylethyl]-2-(5-methylfuran-2-yl)quinoline-4-carboxamide (PubChem CID 9266940) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is N-[(1R)-1-cyclopropylethyl]-2-(5-methylfuran-2-yl)quinoline-4-carboxamide.
| Compound Name | N-[(1R)-1-cyclopropylethyl]-2-(5-methylfuran-2-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 9266940 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | N-[(1R)-1-cyclopropylethyl]-2-(5-methylfuran-2-yl)quinoline-4-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)N[C@H](C)C3CC3)c3ccccc3n2)o1 |
| InChI | InChI=1S/C20H20N2O2/c1-12-7-10-19(24-12)18-11-16(15-5-3-4-6-17(15)22-18)20(23)21-13(2)14-8-9-14/h3-7,10-11,13-14H,8-9H2,1-2H3,(H,21,23)/t13-/m1/s1 |
| InChIKey | ZPLJAGGXHCYGSF-CYBMUJFWSA-N |
| XLogP | 4.33 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |