(4R)-4-(dimethylamino)pentanoic acid

C7H15NO2 — CID 92669584

IUPAC(4R)-4-(dimethylamino)pentanoic acid
SMILESC[C@H](CCC(=O)O)N(C)C
InChIInChI=1S/C7H15NO2/c1-6(8(2)3)4-5-7(9)10/h6H,4-5H2,1-3H3,(H,9,10)/t6-/m1/s1
InChIKeyNYVQMWFPRPLDSH-ZCFIWIBFSA-N
MW145.20 g/mol
LogP0.80
Rot. Bonds4

About (4R)-4-(dimethylamino)pentanoic acid

(4R)-4-(dimethylamino)pentanoic acid (PubChem CID 92669584) has the molecular formula C7H15NO2 and a molecular weight of 145.20 g/mol. Its IUPAC name is (4R)-4-(dimethylamino)pentanoic acid.

Molecular Properties

Compound Name(4R)-4-(dimethylamino)pentanoic acid
PubChem CID92669584
Molecular FormulaC7H15NO2
Molecular Weight145.20 g/mol
Exact Mass145.11
IUPAC Name(4R)-4-(dimethylamino)pentanoic acid
SMILESC[C@H](CCC(=O)O)N(C)C
InChIInChI=1S/C7H15NO2/c1-6(8(2)3)4-5-7(9)10/h6H,4-5H2,1-3H3,(H,9,10)/t6-/m1/s1
InChIKeyNYVQMWFPRPLDSH-ZCFIWIBFSA-N
XLogP0.80
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500145.20
LogP ≤ 50.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (4R)-4-(dimethylamino)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-(dimethylamino)pentanoic acid
CID 18442969
4-[methyl(pentan-3-yl)amino]pentanoic acid
CID 62213096
4-[ethyl(methyl)amino]pentanoic acid
CID 62214342
4-[2-hydroxypropyl(methyl)amino]pentanoic acid
CID 62332604
4-[[2-(dimethylamino)-2-oxoethyl]-methylamino]pentanoic acid
CID 62215247
butanedioic acid;1-(dimethylamino)ethanol
CID 87203618
N,N-dimethylmethanamine;2-methylpentanedioic acid
CID 174605031
4-(dimethylamino)-4-sulfanylbutanoic acid
CID 57084539
4-[cyclopropylmethyl(methyl)amino]pentanoic acid
CID 62213989
4-[methyl(1-thiophen-2-ylethyl)amino]pentanoic acid
CID 62214541
4-[di(docosyl)amino]pentanoic acid
CID 101314329
4-(dioctylamino)pentanoic acid
CID 101313470

Frequently Asked Questions

What is the IUPAC name of (4R)-4-(dimethylamino)pentanoic acid?
The IUPAC name of (4R)-4-(dimethylamino)pentanoic acid (CID 92669584) is (4R)-4-(dimethylamino)pentanoic acid.
What is the SMILES notation for (4R)-4-(dimethylamino)pentanoic acid?
The canonical SMILES for (4R)-4-(dimethylamino)pentanoic acid is C[C@H](CCC(=O)O)N(C)C.
What is the InChIKey of (4R)-4-(dimethylamino)pentanoic acid?
The InChIKey is NYVQMWFPRPLDSH-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H15NO2/c1-6(8(2)3)4-5-7(9)10/h6H,4-5H2,1-3H3,(H,9,10)/t6-/m1/s1.
What are the key properties of (4R)-4-(dimethylamino)pentanoic acid?
(4R)-4-(dimethylamino)pentanoic acid has a molecular weight of 145.20 g/mol, XLogP of 0.80, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-(dimethylamino)pentanoic acid is sourced from PubChem (CID 92669584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).