C19H20Cl2N2O6S — CID 92671753
ethyl 2-chloro-5-[[2-(3-chloro-4-methoxy-N-methylsulfonylanilino)acetyl]amino]benzoate (PubChem CID 92671753) has the molecular formula C19H20Cl2N2O6S and a molecular weight of 475.35 g/mol. Its IUPAC name is ethyl 2-chloro-5-[[2-(3-chloro-4-methoxy-N-methylsulfonylanilino)acetyl]amino]benzoate.
| Compound Name | ethyl 2-chloro-5-[[2-(3-chloro-4-methoxy-N-methylsulfonylanilino)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 92671753 |
| Molecular Formula | C19H20Cl2N2O6S |
| Molecular Weight | 475.35 g/mol |
| Exact Mass | 474.04 |
| IUPAC Name | ethyl 2-chloro-5-[[2-(3-chloro-4-methoxy-N-methylsulfonylanilino)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)CN(c2ccc(OC)c(Cl)c2)S(C)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C19H20Cl2N2O6S/c1-4-29-19(25)14-9-12(5-7-15(14)20)22-18(24)11-23(30(3,26)27)13-6-8-17(28-2)16(21)10-13/h5-10H,4,11H2,1-3H3,(H,22,24) |
| InChIKey | HXJVIWGQHMESSS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |