C20H22N4O3S — CID 92673554
N-[[4-(2-methylimidazol-1-yl)phenyl]methyl]-4-[methyl(methylsulfonyl)amino]benzamide (PubChem CID 92673554) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is N-[[4-(2-methylimidazol-1-yl)phenyl]methyl]-4-[methyl(methylsulfonyl)amino]benzamide.
| Compound Name | N-[[4-(2-methylimidazol-1-yl)phenyl]methyl]-4-[methyl(methylsulfonyl)amino]benzamide |
|---|---|
| PubChem CID | 92673554 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-[[4-(2-methylimidazol-1-yl)phenyl]methyl]-4-[methyl(methylsulfonyl)amino]benzamide |
| SMILES | Cc1nccn1-c1ccc(CNC(=O)c2ccc(N(C)S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C20H22N4O3S/c1-15-21-12-13-24(15)19-8-4-16(5-9-19)14-22-20(25)17-6-10-18(11-7-17)23(2)28(3,26)27/h4-13H,14H2,1-3H3,(H,22,25) |
| InChIKey | WRJMFPAIVUVIRX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |