C20H22ClFN2O5S — CID 92675030
ethyl 2-chloro-5-[4-(4-fluoro-N-methylsulfonylanilino)butanoylamino]benzoate (PubChem CID 92675030) has the molecular formula C20H22ClFN2O5S and a molecular weight of 456.92 g/mol. Its IUPAC name is ethyl 2-chloro-5-[4-(4-fluoro-N-methylsulfonylanilino)butanoylamino]benzoate.
| Compound Name | ethyl 2-chloro-5-[4-(4-fluoro-N-methylsulfonylanilino)butanoylamino]benzoate |
|---|---|
| PubChem CID | 92675030 |
| Molecular Formula | C20H22ClFN2O5S |
| Molecular Weight | 456.92 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | ethyl 2-chloro-5-[4-(4-fluoro-N-methylsulfonylanilino)butanoylamino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)CCCN(c2ccc(F)cc2)S(C)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C20H22ClFN2O5S/c1-3-29-20(26)17-13-15(8-11-18(17)21)23-19(25)5-4-12-24(30(2,27)28)16-9-6-14(22)7-10-16/h6-11,13H,3-5,12H2,1-2H3,(H,23,25) |
| InChIKey | FQEWDNASGAHLPF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.92 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |