C21H23N3O2 — CID 92675979
(2S)-N-[[2-(2-methylimidazol-1-yl)phenyl]methyl]-2-(3-methylphenoxy)propanamide (PubChem CID 92675979) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is (2S)-N-[[2-(2-methylimidazol-1-yl)phenyl]methyl]-2-(3-methylphenoxy)propanamide.
| Compound Name | (2S)-N-[[2-(2-methylimidazol-1-yl)phenyl]methyl]-2-(3-methylphenoxy)propanamide |
|---|---|
| PubChem CID | 92675979 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (2S)-N-[[2-(2-methylimidazol-1-yl)phenyl]methyl]-2-(3-methylphenoxy)propanamide |
| SMILES | Cc1cccc(O[C@@H](C)C(=O)NCc2ccccc2-n2ccnc2C)c1 |
| InChI | InChI=1S/C21H23N3O2/c1-15-7-6-9-19(13-15)26-16(2)21(25)23-14-18-8-4-5-10-20(18)24-12-11-22-17(24)3/h4-13,16H,14H2,1-3H3,(H,23,25)/t16-/m0/s1 |
| InChIKey | RFTJQQOREWDSLC-INIZCTEOSA-N |
| XLogP | 3.57 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |