C21H27NO5 — CID 92677057
3-(3,4-diethoxyphenyl)-N-(2,5-dimethoxyphenyl)propanamide (PubChem CID 92677057) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is 3-(3,4-diethoxyphenyl)-N-(2,5-dimethoxyphenyl)propanamide.
| Compound Name | 3-(3,4-diethoxyphenyl)-N-(2,5-dimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 92677057 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 3-(3,4-diethoxyphenyl)-N-(2,5-dimethoxyphenyl)propanamide |
| SMILES | CCOc1ccc(CCC(=O)Nc2cc(OC)ccc2OC)cc1OCC |
| InChI | InChI=1S/C21H27NO5/c1-5-26-19-10-7-15(13-20(19)27-6-2)8-12-21(23)22-17-14-16(24-3)9-11-18(17)25-4/h7,9-11,13-14H,5-6,8,12H2,1-4H3,(H,22,23) |
| InChIKey | VPKHTDZXXAMDRV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |