C18H27NO2 — CID 92677756
(2R)-1-(azepan-1-yl)-2-(2,3,5-trimethylphenoxy)propan-1-one (PubChem CID 92677756) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is (2R)-1-(azepan-1-yl)-2-(2,3,5-trimethylphenoxy)propan-1-one.
| Compound Name | (2R)-1-(azepan-1-yl)-2-(2,3,5-trimethylphenoxy)propan-1-one |
|---|---|
| PubChem CID | 92677756 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | (2R)-1-(azepan-1-yl)-2-(2,3,5-trimethylphenoxy)propan-1-one |
| SMILES | Cc1cc(C)c(C)c(O[C@H](C)C(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C18H27NO2/c1-13-11-14(2)15(3)17(12-13)21-16(4)18(20)19-9-7-5-6-8-10-19/h11-12,16H,5-10H2,1-4H3/t16-/m1/s1 |
| InChIKey | XMIYTOAZQYNSFP-MRXNPFEDSA-N |
| XLogP | 3.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |