C17H15BrClNO4 — CID 92677982
ethyl 4-[[2-(4-bromophenoxy)acetyl]amino]-2-chlorobenzoate (PubChem CID 92677982) has the molecular formula C17H15BrClNO4 and a molecular weight of 412.67 g/mol. Its IUPAC name is ethyl 4-[[2-(4-bromophenoxy)acetyl]amino]-2-chlorobenzoate.
| Compound Name | ethyl 4-[[2-(4-bromophenoxy)acetyl]amino]-2-chlorobenzoate |
|---|---|
| PubChem CID | 92677982 |
| Molecular Formula | C17H15BrClNO4 |
| Molecular Weight | 412.67 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | ethyl 4-[[2-(4-bromophenoxy)acetyl]amino]-2-chlorobenzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)COc2ccc(Br)cc2)cc1Cl |
| InChI | InChI=1S/C17H15BrClNO4/c1-2-23-17(22)14-8-5-12(9-15(14)19)20-16(21)10-24-13-6-3-11(18)4-7-13/h3-9H,2,10H2,1H3,(H,20,21) |
| InChIKey | KHOQSBHBPOFFQO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.67 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |