C22H21ClN2O3S — CID 92678447
4-(benzenesulfonamido)-3-chloro-N-(2,4,6-trimethylphenyl)benzamide (PubChem CID 92678447) has the molecular formula C22H21ClN2O3S and a molecular weight of 428.94 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-3-chloro-N-(2,4,6-trimethylphenyl)benzamide.
| Compound Name | 4-(benzenesulfonamido)-3-chloro-N-(2,4,6-trimethylphenyl)benzamide |
|---|---|
| PubChem CID | 92678447 |
| Molecular Formula | C22H21ClN2O3S |
| Molecular Weight | 428.94 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 4-(benzenesulfonamido)-3-chloro-N-(2,4,6-trimethylphenyl)benzamide |
| SMILES | Cc1cc(C)c(NC(=O)c2ccc(NS(=O)(=O)c3ccccc3)c(Cl)c2)c(C)c1 |
| InChI | InChI=1S/C22H21ClN2O3S/c1-14-11-15(2)21(16(3)12-14)24-22(26)17-9-10-20(19(23)13-17)25-29(27,28)18-7-5-4-6-8-18/h4-13,25H,1-3H3,(H,24,26) |
| InChIKey | BZCAATWEOWICLO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.94 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |