C22H28N4O3S — CID 92678948
(2S)-2-(4-methyl-1-oxo-[1]benzothiolo[2,3-d]pyridazin-2-yl)-N-(3-morpholin-4-ylpropyl)butanamide (PubChem CID 92678948) has the molecular formula C22H28N4O3S and a molecular weight of 428.56 g/mol. Its IUPAC name is (2S)-2-(4-methyl-1-oxo-[1]benzothiolo[2,3-d]pyridazin-2-yl)-N-(3-morpholin-4-ylpropyl)butanamide.
| Compound Name | (2S)-2-(4-methyl-1-oxo-[1]benzothiolo[2,3-d]pyridazin-2-yl)-N-(3-morpholin-4-ylpropyl)butanamide |
|---|---|
| PubChem CID | 92678948 |
| Molecular Formula | C22H28N4O3S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | (2S)-2-(4-methyl-1-oxo-[1]benzothiolo[2,3-d]pyridazin-2-yl)-N-(3-morpholin-4-ylpropyl)butanamide |
| SMILES | CC[C@@H](C(=O)NCCCN1CCOCC1)n1nc(C)c2sc3ccccc3c2c1=O |
| InChI | InChI=1S/C22H28N4O3S/c1-3-17(21(27)23-9-6-10-25-11-13-29-14-12-25)26-22(28)19-16-7-4-5-8-18(16)30-20(19)15(2)24-26/h4-5,7-8,17H,3,6,9-14H2,1-2H3,(H,23,27)/t17-/m0/s1 |
| InChIKey | AEFSPJYKVTVTCU-KRWDZBQOSA-N |
| XLogP | 2.71 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|