C19H23N3O3 — CID 92680309
3-[(3,4-dioxo-2-pyrrolidin-1-ylcyclobuten-1-yl)amino]-N-[(1S)-1-phenylethyl]propanamide (PubChem CID 92680309) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 3-[(3,4-dioxo-2-pyrrolidin-1-ylcyclobuten-1-yl)amino]-N-[(1S)-1-phenylethyl]propanamide.
| Compound Name | 3-[(3,4-dioxo-2-pyrrolidin-1-ylcyclobuten-1-yl)amino]-N-[(1S)-1-phenylethyl]propanamide |
|---|---|
| PubChem CID | 92680309 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 3-[(3,4-dioxo-2-pyrrolidin-1-ylcyclobuten-1-yl)amino]-N-[(1S)-1-phenylethyl]propanamide |
| SMILES | C[C@H](NC(=O)CCNc1c(N2CCCC2)c(=O)c1=O)c1ccccc1 |
| InChI | InChI=1S/C19H23N3O3/c1-13(14-7-3-2-4-8-14)21-15(23)9-10-20-16-17(19(25)18(16)24)22-11-5-6-12-22/h2-4,7-8,13,20H,5-6,9-12H2,1H3,(H,21,23)/t13-/m0/s1 |
| InChIKey | FZHDUELGJROWKB-ZDUSSCGKSA-N |
| XLogP | 1.56 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|