C18H29N3O2 — CID 9268036
N-[4-[[[(2S)-4-(2-methylpropyl)morpholin-2-yl]methylamino]methyl]phenyl]acetamide (PubChem CID 9268036) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is N-[4-[[[(2S)-4-(2-methylpropyl)morpholin-2-yl]methylamino]methyl]phenyl]acetamide.
| Compound Name | N-[4-[[[(2S)-4-(2-methylpropyl)morpholin-2-yl]methylamino]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 9268036 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | N-[4-[[[(2S)-4-(2-methylpropyl)morpholin-2-yl]methylamino]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CNC[C@H]2CN(CC(C)C)CCO2)cc1 |
| InChI | InChI=1S/C18H29N3O2/c1-14(2)12-21-8-9-23-18(13-21)11-19-10-16-4-6-17(7-5-16)20-15(3)22/h4-7,14,18-19H,8-13H2,1-3H3,(H,20,22)/t18-/m0/s1 |
| InChIKey | QXBTWVWXUCAWPR-SFHVURJKSA-N |
| XLogP | 2.09 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |