C21H23N5O5S2 — CID 92680973
2-(4-ethyl-N-methylsulfonylanilino)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]acetamide (PubChem CID 92680973) has the molecular formula C21H23N5O5S2 and a molecular weight of 489.58 g/mol. Its IUPAC name is 2-(4-ethyl-N-methylsulfonylanilino)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(4-ethyl-N-methylsulfonylanilino)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 92680973 |
| Molecular Formula | C21H23N5O5S2 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 2-(4-ethyl-N-methylsulfonylanilino)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]acetamide |
| SMILES | CCc1ccc(N(CC(=O)Nc2ccc(S(=O)(=O)Nc3ncccn3)cc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H23N5O5S2/c1-3-16-5-9-18(10-6-16)26(32(2,28)29)15-20(27)24-17-7-11-19(12-8-17)33(30,31)25-21-22-13-4-14-23-21/h4-14H,3,15H2,1-2H3,(H,24,27)(H,22,23,25) |
| InChIKey | HBVMNHJBJUKBGH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |