C18H19F2NO2 — CID 92682069
(2R)-N-(3,4-difluorophenyl)-2-(3,4-dimethylphenoxy)butanamide (PubChem CID 92682069) has the molecular formula C18H19F2NO2 and a molecular weight of 319.35 g/mol. Its IUPAC name is (2R)-N-(3,4-difluorophenyl)-2-(3,4-dimethylphenoxy)butanamide.
| Compound Name | (2R)-N-(3,4-difluorophenyl)-2-(3,4-dimethylphenoxy)butanamide |
|---|---|
| PubChem CID | 92682069 |
| Molecular Formula | C18H19F2NO2 |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (2R)-N-(3,4-difluorophenyl)-2-(3,4-dimethylphenoxy)butanamide |
| SMILES | CC[C@@H](Oc1ccc(C)c(C)c1)C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H19F2NO2/c1-4-17(23-14-7-5-11(2)12(3)9-14)18(22)21-13-6-8-15(19)16(20)10-13/h5-10,17H,4H2,1-3H3,(H,21,22)/t17-/m1/s1 |
| InChIKey | IKUZQPBPRNUKEN-QGZVFWFLSA-N |
| XLogP | 4.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |